Skip to content
qorganica.es qorganica.comOrganic Chemistry made transparent Course map Español

Problems and exercisesStructure and Nomenclature

1. General formula

Write the molecular formula of the alkanes with 5, 8 and 20 carbon atoms. How many hydrogen atoms does an alkane with n carbons have?

2. Isomers of pentane

Draw and name all the isomers of formula C5H12.

3. Types of carbon

In 2,2,4-trimethylpentane, (CH3)3CCH2CH(CH3)2, state how many primary, secondary, tertiary and quaternary carbons there are.

4. Name these alkanes

  1. CH3CH(CH3)CH2CH3
  2. CH3CH2CH(CH2CH3)CH2CH3
  3. (CH3)2CHCH(CH3)2
  4. CH3CH2CH2CH(CH3)CH2CH2CH3

5. Is there a stereocentre?

Which of these alkanes have a stereocentre?

  1. 3-Methylpentane
  2. 3-Methylhexane
  3. 2-Methylbutane
  4. 2,3-Dimethylpentane

See the solutions →